C15H20N4O2S — CID 169361073
methyl N-cyano-N'-[4-methoxy-3-(pentanoylamino)phenyl]carbamimidothioate (PubChem CID 169361073) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is methyl N-cyano-N'-[4-methoxy-3-(pentanoylamino)phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[4-methoxy-3-(pentanoylamino)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169361073 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | methyl N-cyano-N'-[4-methoxy-3-(pentanoylamino)phenyl]carbamimidothioate |
| SMILES | CCCCC(=O)Nc1cc(/N=C(/NC#N)SC)ccc1OC |
| InChI | InChI=1S/C15H20N4O2S/c1-4-5-6-14(20)19-12-9-11(7-8-13(12)21-2)18-15(22-3)17-10-16/h7-9H,4-6H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | HQMBMGSIJMVORC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 86.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|