C20H27N5OS — CID 169364115
methyl N-cyano-N'-[4-(4-cyclohexylpiperazine-1-carbonyl)phenyl]carbamimidothioate (PubChem CID 169364115) has the molecular formula C20H27N5OS and a molecular weight of 385.54 g/mol. Its IUPAC name is methyl N-cyano-N'-[4-(4-cyclohexylpiperazine-1-carbonyl)phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[4-(4-cyclohexylpiperazine-1-carbonyl)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169364115 |
| Molecular Formula | C20H27N5OS |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | methyl N-cyano-N'-[4-(4-cyclohexylpiperazine-1-carbonyl)phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1ccc(C(=O)N2CCN(C3CCCCC3)CC2)cc1)NC#N |
| InChI | InChI=1S/C20H27N5OS/c1-27-20(22-15-21)23-17-9-7-16(8-10-17)19(26)25-13-11-24(12-14-25)18-5-3-2-4-6-18/h7-10,18H,2-6,11-14H2,1H3,(H,22,23) |
| InChIKey | VMNSHDDHPZFMIS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 71.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|