C15H22ClN3 — CID 169365970
2-chloro-N'-[3-[(2-methylpiperidin-1-yl)methyl]phenyl]ethanimidamide (PubChem CID 169365970) has the molecular formula C15H22ClN3 and a molecular weight of 279.82 g/mol. Its IUPAC name is 2-chloro-N'-[3-[(2-methylpiperidin-1-yl)methyl]phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[3-[(2-methylpiperidin-1-yl)methyl]phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169365970 |
| Molecular Formula | C15H22ClN3 |
| Molecular Weight | 279.82 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-chloro-N'-[3-[(2-methylpiperidin-1-yl)methyl]phenyl]ethanimidamide |
| SMILES | CC1CCCCN1Cc1cccc(/N=C(/N)CCl)c1 |
| InChI | InChI=1S/C15H22ClN3/c1-12-5-2-3-8-19(12)11-13-6-4-7-14(9-13)18-15(17)10-16/h4,6-7,9,12H,2-3,5,8,10-11H2,1H3,(H2,17,18) |
| InChIKey | FNYSOWXHNVCGAY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.82 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|