C14H20ClN3 — CID 169368063
2-chloro-N'-[4-(2-methylpiperidin-1-yl)phenyl]ethanimidamide (PubChem CID 169368063) has the molecular formula C14H20ClN3 and a molecular weight of 265.79 g/mol. Its IUPAC name is 2-chloro-N'-[4-(2-methylpiperidin-1-yl)phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[4-(2-methylpiperidin-1-yl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169368063 |
| Molecular Formula | C14H20ClN3 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2-chloro-N'-[4-(2-methylpiperidin-1-yl)phenyl]ethanimidamide |
| SMILES | CC1CCCCN1c1ccc(/N=C(/N)CCl)cc1 |
| InChI | InChI=1S/C14H20ClN3/c1-11-4-2-3-9-18(11)13-7-5-12(6-8-13)17-14(16)10-15/h5-8,11H,2-4,9-10H2,1H3,(H2,16,17) |
| InChIKey | YTGVCPQLIJGXQM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|