C15H15ClN4O — CID 169367040
4-[(1-amino-2-chloroethylidene)amino]-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 169367040) has the molecular formula C15H15ClN4O and a molecular weight of 302.77 g/mol. Its IUPAC name is 4-[(1-amino-2-chloroethylidene)amino]-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 4-[(1-amino-2-chloroethylidene)amino]-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 169367040 |
| Molecular Formula | C15H15ClN4O |
| Molecular Weight | 302.77 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 4-[(1-amino-2-chloroethylidene)amino]-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | N/C(CCl)=N/c1ccc(C(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C15H15ClN4O/c16-8-14(17)20-13-5-3-12(4-6-13)15(21)19-10-11-2-1-7-18-9-11/h1-7,9H,8,10H2,(H2,17,20)(H,19,21) |
| InChIKey | RMGUYBJYAFZNTH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.77 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|