C15H19ClN4 — CID 169367311
2-chloro-N'-(2-cyclohexyl-3H-benzimidazol-5-yl)ethanimidamide (PubChem CID 169367311) has the molecular formula C15H19ClN4 and a molecular weight of 290.80 g/mol. Its IUPAC name is 2-chloro-N'-(2-cyclohexyl-3H-benzimidazol-5-yl)ethanimidamide.
| Compound Name | 2-chloro-N'-(2-cyclohexyl-3H-benzimidazol-5-yl)ethanimidamide |
|---|---|
| PubChem CID | 169367311 |
| Molecular Formula | C15H19ClN4 |
| Molecular Weight | 290.80 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-chloro-N'-(2-cyclohexyl-3H-benzimidazol-5-yl)ethanimidamide |
| SMILES | N/C(CCl)=N/c1ccc2nc(C3CCCCC3)[nH]c2c1 |
| InChI | InChI=1S/C15H19ClN4/c16-9-14(17)18-11-6-7-12-13(8-11)20-15(19-12)10-4-2-1-3-5-10/h6-8,10H,1-5,9H2,(H2,17,18)(H,19,20) |
| InChIKey | BANPCQCSNAEJQB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.80 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|