C13H15ClN4O2 — CID 169367879
2-chloro-N'-[5-(5-ethyl-1,3,4-oxadiazol-2-yl)-2-methoxyphenyl]ethanimidamide (PubChem CID 169367879) has the molecular formula C13H15ClN4O2 and a molecular weight of 294.74 g/mol. Its IUPAC name is 2-chloro-N'-[5-(5-ethyl-1,3,4-oxadiazol-2-yl)-2-methoxyphenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[5-(5-ethyl-1,3,4-oxadiazol-2-yl)-2-methoxyphenyl]ethanimidamide |
|---|---|
| PubChem CID | 169367879 |
| Molecular Formula | C13H15ClN4O2 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-chloro-N'-[5-(5-ethyl-1,3,4-oxadiazol-2-yl)-2-methoxyphenyl]ethanimidamide |
| SMILES | CCc1nnc(-c2ccc(OC)c(/N=C(/N)CCl)c2)o1 |
| InChI | InChI=1S/C13H15ClN4O2/c1-3-12-17-18-13(20-12)8-4-5-10(19-2)9(6-8)16-11(15)7-14/h4-6H,3,7H2,1-2H3,(H2,15,16) |
| InChIKey | ZBDSHZYKRAGEFY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 86.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|