C16H16ClN3O3 — CID 169368008
ethyl 2-[3-[(1-amino-2-chloroethylidene)amino]phenoxy]pyridine-4-carboxylate (PubChem CID 169368008) has the molecular formula C16H16ClN3O3 and a molecular weight of 333.78 g/mol. Its IUPAC name is ethyl 2-[3-[(1-amino-2-chloroethylidene)amino]phenoxy]pyridine-4-carboxylate.
| Compound Name | ethyl 2-[3-[(1-amino-2-chloroethylidene)amino]phenoxy]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 169368008 |
| Molecular Formula | C16H16ClN3O3 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | ethyl 2-[3-[(1-amino-2-chloroethylidene)amino]phenoxy]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(Oc2cccc(/N=C(/N)CCl)c2)c1 |
| InChI | InChI=1S/C16H16ClN3O3/c1-2-22-16(21)11-6-7-19-15(8-11)23-13-5-3-4-12(9-13)20-14(18)10-17/h3-9H,2,10H2,1H3,(H2,18,20) |
| InChIKey | KUFXMZIVBMJHNA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|