C14H23ClN2O4Si — CID 169368917
2-chloro-N'-[3-(3-trimethoxysilylpropoxy)phenyl]ethanimidamide (PubChem CID 169368917) has the molecular formula C14H23ClN2O4Si and a molecular weight of 346.89 g/mol. Its IUPAC name is 2-chloro-N'-[3-(3-trimethoxysilylpropoxy)phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[3-(3-trimethoxysilylpropoxy)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169368917 |
| Molecular Formula | C14H23ClN2O4Si |
| Molecular Weight | 346.89 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 2-chloro-N'-[3-(3-trimethoxysilylpropoxy)phenyl]ethanimidamide |
| SMILES | CO[Si](CCCOc1cccc(/N=C(/N)CCl)c1)(OC)OC |
| InChI | InChI=1S/C14H23ClN2O4Si/c1-18-22(19-2,20-3)9-5-8-21-13-7-4-6-12(10-13)17-14(16)11-15/h4,6-7,10H,5,8-9,11H2,1-3H3,(H2,16,17) |
| InChIKey | IHKNHJWSWINYJH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 75.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.89 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|