C11H15ClN2O2 — CID 169366194
2-chloro-N'-[3-(2-methoxyethoxy)phenyl]ethanimidamide (PubChem CID 169366194) has the molecular formula C11H15ClN2O2 and a molecular weight of 242.71 g/mol. Its IUPAC name is 2-chloro-N'-[3-(2-methoxyethoxy)phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[3-(2-methoxyethoxy)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169366194 |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-chloro-N'-[3-(2-methoxyethoxy)phenyl]ethanimidamide |
| SMILES | COCCOc1cccc(/N=C(/N)CCl)c1 |
| InChI | InChI=1S/C11H15ClN2O2/c1-15-5-6-16-10-4-2-3-9(7-10)14-11(13)8-12/h2-4,7H,5-6,8H2,1H3,(H2,13,14) |
| InChIKey | PXGQWNIRCFDHLI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|