C12H17ClFN3O — CID 169368485
2-chloro-N'-[2-fluoro-6-(3-methoxypropylamino)phenyl]ethanimidamide (PubChem CID 169368485) has the molecular formula C12H17ClFN3O and a molecular weight of 273.74 g/mol. Its IUPAC name is 2-chloro-N'-[2-fluoro-6-(3-methoxypropylamino)phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[2-fluoro-6-(3-methoxypropylamino)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169368485 |
| Molecular Formula | C12H17ClFN3O |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-chloro-N'-[2-fluoro-6-(3-methoxypropylamino)phenyl]ethanimidamide |
| SMILES | COCCCNc1cccc(F)c1/N=C(/N)CCl |
| InChI | InChI=1S/C12H17ClFN3O/c1-18-7-3-6-16-10-5-2-4-9(14)12(10)17-11(15)8-13/h2,4-5,16H,3,6-8H2,1H3,(H2,15,17) |
| InChIKey | JCBQLAQCJYBKPB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|