C22H22FN3O — CID 118242935
N'-(2-fluorophenyl)-2-[2-(2-methoxyethylamino)phenyl]benzenecarboximidamide (PubChem CID 118242935) has the molecular formula C22H22FN3O and a molecular weight of 363.44 g/mol. Its IUPAC name is N'-(2-fluorophenyl)-2-[2-(2-methoxyethylamino)phenyl]benzenecarboximidamide.
| Compound Name | N'-(2-fluorophenyl)-2-[2-(2-methoxyethylamino)phenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 118242935 |
| Molecular Formula | C22H22FN3O |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | N'-(2-fluorophenyl)-2-[2-(2-methoxyethylamino)phenyl]benzenecarboximidamide |
| SMILES | COCCNc1ccccc1-c1ccccc1/C(N)=N/c1ccccc1F |
| InChI | InChI=1S/C22H22FN3O/c1-27-15-14-25-20-12-6-4-9-17(20)16-8-2-3-10-18(16)22(24)26-21-13-7-5-11-19(21)23/h2-13,25H,14-15H2,1H3,(H2,24,26) |
| InChIKey | OKABLNVCWBJICG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|