C23H30N2O4S — CID 169370645
tert-butyl 3-[4-[(4-methylphenyl)sulfonylamino]phenyl]piperidine-1-carboxylate (PubChem CID 169370645) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is tert-butyl 3-[4-[(4-methylphenyl)sulfonylamino]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-[(4-methylphenyl)sulfonylamino]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169370645 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | tert-butyl 3-[4-[(4-methylphenyl)sulfonylamino]phenyl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C3CCCN(C(=O)OC(C)(C)C)C3)cc2)cc1 |
| InChI | InChI=1S/C23H30N2O4S/c1-17-7-13-21(14-8-17)30(27,28)24-20-11-9-18(10-12-20)19-6-5-15-25(16-19)22(26)29-23(2,3)4/h7-14,19,24H,5-6,15-16H2,1-4H3 |
| InChIKey | QVHRJFXYIYLILQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |