C17H18N2O2S — CID 169371827
N-(1,3-dimethylindol-6-yl)-4-methylbenzenesulfonamide (PubChem CID 169371827) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is N-(1,3-dimethylindol-6-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(1,3-dimethylindol-6-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 169371827 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-(1,3-dimethylindol-6-yl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc3c(C)cn(C)c3c2)cc1 |
| InChI | InChI=1S/C17H18N2O2S/c1-12-4-7-15(8-5-12)22(20,21)18-14-6-9-16-13(2)11-19(3)17(16)10-14/h4-11,18H,1-3H3 |
| InChIKey | JSYAZYALNNZQRW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |