C10H10ClNO2S — CID 83825091
1,3-dimethylindole-5-sulfonyl chloride (PubChem CID 83825091) has the molecular formula C10H10ClNO2S and a molecular weight of 243.72 g/mol. Its IUPAC name is 1,3-dimethylindole-5-sulfonyl chloride.
| Compound Name | 1,3-dimethylindole-5-sulfonyl chloride |
|---|---|
| PubChem CID | 83825091 |
| Molecular Formula | C10H10ClNO2S |
| Molecular Weight | 243.72 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 1,3-dimethylindole-5-sulfonyl chloride |
| SMILES | Cc1cn(C)c2ccc(S(=O)(=O)Cl)cc12 |
| InChI | InChI=1S/C10H10ClNO2S/c1-7-6-12(2)10-4-3-8(5-9(7)10)15(11,13)14/h3-6H,1-2H3 |
| InChIKey | KRQLMEANKIEHRQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.72 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |