C25H30N6O — CID 169375877
5-[2-(4-tert-butylphenyl)-1,3-benzoxazol-6-yl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine (PubChem CID 169375877) has the molecular formula C25H30N6O and a molecular weight of 430.56 g/mol. Its IUPAC name is 5-[2-(4-tert-butylphenyl)-1,3-benzoxazol-6-yl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine.
| Compound Name | 5-[2-(4-tert-butylphenyl)-1,3-benzoxazol-6-yl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 169375877 |
| Molecular Formula | C25H30N6O |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 5-[2-(4-tert-butylphenyl)-1,3-benzoxazol-6-yl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
| SMILES | CC(C)(C)c1ccc(-c2nc3ccc(N4C(N)=NC(N)=NC45CCCCC5)cc3o2)cc1 |
| InChI | InChI=1S/C25H30N6O/c1-24(2,3)17-9-7-16(8-10-17)21-28-19-12-11-18(15-20(19)32-21)31-23(27)29-22(26)30-25(31)13-5-4-6-14-25/h7-12,15H,4-6,13-14H2,1-3H3,(H4,26,27,29,30) |
| InChIKey | LFYUKSYOXUPCBM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |