C22H32N6O2 — CID 169377353
2-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-2,6-dimethylphenoxy]-1-pyrrolidin-1-ylethanone (PubChem CID 169377353) has the molecular formula C22H32N6O2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 2-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-2,6-dimethylphenoxy]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-2,6-dimethylphenoxy]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 169377353 |
| Molecular Formula | C22H32N6O2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 2-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-2,6-dimethylphenoxy]-1-pyrrolidin-1-ylethanone |
| SMILES | Cc1cc(N2C(N)=NC(N)=NC23CCCCC3)cc(C)c1OCC(=O)N1CCCC1 |
| InChI | InChI=1S/C22H32N6O2/c1-15-12-17(13-16(2)19(15)30-14-18(29)27-10-6-7-11-27)28-21(24)25-20(23)26-22(28)8-4-3-5-9-22/h12-13H,3-11,14H2,1-2H3,(H4,23,24,25,26) |
| InChIKey | MLNQEEDDUIUWAU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |