C19H30N6O — CID 169378363
2-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N-ethyl-3-methylanilino]ethanol (PubChem CID 169378363) has the molecular formula C19H30N6O and a molecular weight of 358.49 g/mol. Its IUPAC name is 2-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N-ethyl-3-methylanilino]ethanol.
| Compound Name | 2-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N-ethyl-3-methylanilino]ethanol |
|---|---|
| PubChem CID | 169378363 |
| Molecular Formula | C19H30N6O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 2-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N-ethyl-3-methylanilino]ethanol |
| SMILES | CCN(CCO)c1ccc(N2C(N)=NC(N)=NC23CCCCC3)c(C)c1 |
| InChI | InChI=1S/C19H30N6O/c1-3-24(11-12-26)15-7-8-16(14(2)13-15)25-18(21)22-17(20)23-19(25)9-5-4-6-10-19/h7-8,13,26H,3-6,9-12H2,1-2H3,(H4,20,21,22,23) |
| InChIKey | MWIZCTYOMQZMML-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|