C23H27N9O — CID 169380201
[5,7-diamino-6-cyano-4-[2-[2-(3-methylpiperidin-1-yl)ethoxy]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169380201) has the molecular formula C23H27N9O and a molecular weight of 445.53 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-[2-[2-(3-methylpiperidin-1-yl)ethoxy]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-[2-[2-(3-methylpiperidin-1-yl)ethoxy]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169380201 |
| Molecular Formula | C23H27N9O |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | [5,7-diamino-6-cyano-4-[2-[2-(3-methylpiperidin-1-yl)ethoxy]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | CC1CCCN(CCOc2ccccc2C2N=C(NC#N)Nc3nc(N)c(C#N)c(N)c32)C1 |
| InChI | InChI=1S/C23H27N9O/c1-14-5-4-8-32(12-14)9-10-33-17-7-3-2-6-15(17)20-18-19(26)16(11-24)21(27)30-22(18)31-23(29-20)28-13-25/h2-3,6-7,14,20H,4-5,8-10,12H2,1H3,(H6,26,27,28,29,30,31) |
| InChIKey | GHNZHBKSDZTMQK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 161.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|