C24H29N9O — CID 169380187
[5,7-diamino-6-cyano-4-[2-(4-piperidin-1-ylbutoxy)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169380187) has the molecular formula C24H29N9O and a molecular weight of 459.56 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-[2-(4-piperidin-1-ylbutoxy)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-[2-(4-piperidin-1-ylbutoxy)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169380187 |
| Molecular Formula | C24H29N9O |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | [5,7-diamino-6-cyano-4-[2-(4-piperidin-1-ylbutoxy)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | N#CNC1=NC(c2ccccc2OCCCCN2CCCCC2)c2c(nc(N)c(C#N)c2N)N1 |
| InChI | InChI=1S/C24H29N9O/c25-14-17-20(27)19-21(30-24(29-15-26)32-23(19)31-22(17)28)16-8-2-3-9-18(16)34-13-7-6-12-33-10-4-1-5-11-33/h2-3,8-9,21H,1,4-7,10-13H2,(H6,27,28,29,30,31,32) |
| InChIKey | RWSYPPJJFHPMAY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 161.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|