C21H23N9 — CID 169378995
[5,7-diamino-6-cyano-4-[2-(piperidin-1-ylmethyl)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169378995) has the molecular formula C21H23N9 and a molecular weight of 401.48 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-[2-(piperidin-1-ylmethyl)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-[2-(piperidin-1-ylmethyl)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169378995 |
| Molecular Formula | C21H23N9 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | [5,7-diamino-6-cyano-4-[2-(piperidin-1-ylmethyl)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | N#CNC1=NC(c2ccccc2CN2CCCCC2)c2c(nc(N)c(C#N)c2N)N1 |
| InChI | InChI=1S/C21H23N9/c22-10-15-17(24)16-18(27-21(26-12-23)29-20(16)28-19(15)25)14-7-3-2-6-13(14)11-30-8-4-1-5-9-30/h2-3,6-7,18H,1,4-5,8-9,11H2,(H6,24,25,26,27,28,29) |
| InChIKey | ONOZFRPPPZAAJY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 152.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|