C20H23N9O2 — CID 169380204
[5,7-diamino-6-cyano-4-[2-[2-(dimethylamino)ethoxy]-3-methoxyphenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169380204) has the molecular formula C20H23N9O2 and a molecular weight of 421.47 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-[2-[2-(dimethylamino)ethoxy]-3-methoxyphenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-[2-[2-(dimethylamino)ethoxy]-3-methoxyphenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169380204 |
| Molecular Formula | C20H23N9O2 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | [5,7-diamino-6-cyano-4-[2-[2-(dimethylamino)ethoxy]-3-methoxyphenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | COc1cccc(C2N=C(NC#N)Nc3nc(N)c(C#N)c(N)c32)c1OCCN(C)C |
| InChI | InChI=1S/C20H23N9O2/c1-29(2)7-8-31-17-11(5-4-6-13(17)30-3)16-14-15(23)12(9-21)18(24)27-19(14)28-20(26-16)25-10-22/h4-6,16H,7-8H2,1-3H3,(H6,23,24,25,26,27,28) |
| InChIKey | VDLCJRDBVCMZDT-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 170.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|