C22H31N3 — CID 169385846
1-[[2,5-dimethyl-3-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]-2-phenylhydrazine (PubChem CID 169385846) has the molecular formula C22H31N3 and a molecular weight of 337.51 g/mol. Its IUPAC name is 1-[[2,5-dimethyl-3-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]-2-phenylhydrazine.
| Compound Name | 1-[[2,5-dimethyl-3-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 169385846 |
| Molecular Formula | C22H31N3 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.25 |
| IUPAC Name | 1-[[2,5-dimethyl-3-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]-2-phenylhydrazine |
| SMILES | Cc1cc(CNNc2ccccc2)c(C)c(CN2CCC(C)CC2)c1 |
| InChI | InChI=1S/C22H31N3/c1-17-9-11-25(12-10-17)16-21-14-18(2)13-20(19(21)3)15-23-24-22-7-5-4-6-8-22/h4-8,13-14,17,23-24H,9-12,15-16H2,1-3H3 |
| InChIKey | QXYJITBPZBYFQW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|