C25H40N2O5 — CID 154922775
(3aR,6aS)-2-[[2,5-dimethyl-3-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol;formic acid (PubChem CID 154922775) has the molecular formula C25H40N2O5 and a molecular weight of 448.60 g/mol. Its IUPAC name is (3aR,6aS)-2-[[2,5-dimethyl-3-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol;formic acid.
| Compound Name | (3aR,6aS)-2-[[2,5-dimethyl-3-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol;formic acid |
|---|---|
| PubChem CID | 154922775 |
| Molecular Formula | C25H40N2O5 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | (3aR,6aS)-2-[[2,5-dimethyl-3-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol;formic acid |
| SMILES | Cc1cc(CN2CCC(C)CC2)c(C)c(CN2C[C@H]3CC(O)C[C@H]3C2)c1.O=CO.O=CO |
| InChI | InChI=1S/C23H36N2O.2CH2O2/c1-16-4-6-24(7-5-16)12-19-8-17(2)9-20(18(19)3)13-25-14-21-10-23(26)11-22(21)15-25;2*2-1-3/h8-9,16,21-23,26H,4-7,10-15H2,1-3H3;2*1H,(H,2,3)/t21-,22+,23?;; |
| InChIKey | IVPZRFUQFFMBOH-KMLHKAFLSA-N |
| XLogP | 3.14 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|