C22H33N3OS — CID 159734505
[(2S)-4-[[3-(3-amino-2-sulfanylidenepropyl)-2,5-dimethylphenyl]methyl]-2-methylpiperazin-1-yl]-cyclobutylmethanone (PubChem CID 159734505) has the molecular formula C22H33N3OS and a molecular weight of 387.59 g/mol. Its IUPAC name is [(2S)-4-[[3-(3-amino-2-sulfanylidenepropyl)-2,5-dimethylphenyl]methyl]-2-methylpiperazin-1-yl]-cyclobutylmethanone.
| Compound Name | [(2S)-4-[[3-(3-amino-2-sulfanylidenepropyl)-2,5-dimethylphenyl]methyl]-2-methylpiperazin-1-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 159734505 |
| Molecular Formula | C22H33N3OS |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | [(2S)-4-[[3-(3-amino-2-sulfanylidenepropyl)-2,5-dimethylphenyl]methyl]-2-methylpiperazin-1-yl]-cyclobutylmethanone |
| SMILES | Cc1cc(CC(=S)CN)c(C)c(CN2CCN(C(=O)C3CCC3)[C@@H](C)C2)c1 |
| InChI | InChI=1S/C22H33N3OS/c1-15-9-19(11-21(27)12-23)17(3)20(10-15)14-24-7-8-25(16(2)13-24)22(26)18-5-4-6-18/h9-10,16,18H,4-8,11-14,23H2,1-3H3/t16-/m0/s1 |
| InChIKey | VLJIHRDMJRXOHC-INIZCTEOSA-N |
| XLogP | 3.01 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|