C19H31N5O2 — CID 145440557
1-amino-3-[3-[[(3S)-4-(cyclopropanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2,5-dimethylphenyl]urea;molecular hydrogen (PubChem CID 145440557) has the molecular formula C19H31N5O2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 1-amino-3-[3-[[(3S)-4-(cyclopropanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2,5-dimethylphenyl]urea;molecular hydrogen.
| Compound Name | 1-amino-3-[3-[[(3S)-4-(cyclopropanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2,5-dimethylphenyl]urea;molecular hydrogen |
|---|---|
| PubChem CID | 145440557 |
| Molecular Formula | C19H31N5O2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | 1-amino-3-[3-[[(3S)-4-(cyclopropanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2,5-dimethylphenyl]urea;molecular hydrogen |
| SMILES | Cc1cc(CN2CCN(C(=O)C3CC3)[C@@H](C)C2)c(C)c(NC(=O)NN)c1.[H][H] |
| InChI | InChI=1S/C19H29N5O2.H2/c1-12-8-16(14(3)17(9-12)21-19(26)22-20)11-23-6-7-24(13(2)10-23)18(25)15-4-5-15;/h8-9,13,15H,4-7,10-11,20H2,1-3H3,(H2,21,22,26);1H/t13-;/m0./s1 |
| InChIKey | SRSHEERSQWFIOT-ZOWNYOTGSA-N |
| XLogP | 1.99 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|