C17H18BrN3O — CID 169386228
4-[4-bromo-2-[(2-phenylhydrazinyl)methyl]phenoxy]butanenitrile (PubChem CID 169386228) has the molecular formula C17H18BrN3O and a molecular weight of 360.26 g/mol. Its IUPAC name is 4-[4-bromo-2-[(2-phenylhydrazinyl)methyl]phenoxy]butanenitrile.
| Compound Name | 4-[4-bromo-2-[(2-phenylhydrazinyl)methyl]phenoxy]butanenitrile |
|---|---|
| PubChem CID | 169386228 |
| Molecular Formula | C17H18BrN3O |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 4-[4-bromo-2-[(2-phenylhydrazinyl)methyl]phenoxy]butanenitrile |
| SMILES | N#CCCCOc1ccc(Br)cc1CNNc1ccccc1 |
| InChI | InChI=1S/C17H18BrN3O/c18-15-8-9-17(22-11-5-4-10-19)14(12-15)13-20-21-16-6-2-1-3-7-16/h1-3,6-9,12,20-21H,4-5,11,13H2 |
| InChIKey | MOYRZNMFBRXTEX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 57.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|