C21H21N5O6 — CID 169391206
ethyl 6-amino-5-cyano-4-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-2-methyl-4H-pyran-3-carboxylate (PubChem CID 169391206) has the molecular formula C21H21N5O6 and a molecular weight of 439.43 g/mol. Its IUPAC name is ethyl 6-amino-5-cyano-4-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-5-cyano-4-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169391206 |
| Molecular Formula | C21H21N5O6 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | ethyl 6-amino-5-cyano-4-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-2-methyl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1ccc(OC)c(Cn2cc([N+](=O)[O-])cn2)c1 |
| InChI | InChI=1S/C21H21N5O6/c1-4-31-21(27)18-12(2)32-20(23)16(8-22)19(18)13-5-6-17(30-3)14(7-13)10-25-11-15(9-24-25)26(28)29/h5-7,9,11,19H,4,10,23H2,1-3H3 |
| InChIKey | UIANZSQWQHOVJJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 155.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|