C26H23N7O4 — CID 23792988
5-amino-7-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-2-methyl-4-(4-methylphenyl)-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile (PubChem CID 23792988) has the molecular formula C26H23N7O4 and a molecular weight of 497.52 g/mol. Its IUPAC name is 5-amino-7-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-2-methyl-4-(4-methylphenyl)-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile.
| Compound Name | 5-amino-7-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-2-methyl-4-(4-methylphenyl)-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 23792988 |
| Molecular Formula | C26H23N7O4 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 5-amino-7-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-2-methyl-4-(4-methylphenyl)-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile |
| SMILES | COc1ccc(C2C(C#N)=C(N)N(c3ccc(C)cc3)c3oc(C)nc32)cc1Cn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C26H23N7O4/c1-15-4-7-19(8-5-15)32-25(28)21(11-27)23(24-26(32)37-16(2)30-24)17-6-9-22(36-3)18(10-17)13-31-14-20(12-29-31)33(34)35/h4-10,12,14,23H,13,28H2,1-3H3 |
| InChIKey | FTHNFQOCHGVXGY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 149.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|