C26H23N5O4 — CID 1131653
(2S)-3-benzyl-2-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-1,2-dihydroquinazolin-4-one (PubChem CID 1131653) has the molecular formula C26H23N5O4 and a molecular weight of 469.50 g/mol. Its IUPAC name is (2S)-3-benzyl-2-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-1,2-dihydroquinazolin-4-one.
| Compound Name | (2S)-3-benzyl-2-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 1131653 |
| Molecular Formula | C26H23N5O4 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | (2S)-3-benzyl-2-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-1,2-dihydroquinazolin-4-one |
| SMILES | COc1ccc([C@H]2Nc3ccccc3C(=O)N2Cc2ccccc2)cc1Cn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C26H23N5O4/c1-35-24-12-11-19(13-20(24)16-29-17-21(14-27-29)31(33)34)25-28-23-10-6-5-9-22(23)26(32)30(25)15-18-7-3-2-4-8-18/h2-14,17,25,28H,15-16H2,1H3/t25-/m0/s1 |
| InChIKey | BZWNKUGMWXJQII-VWLOTQADSA-N |
| XLogP | 4.61 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|