C24H23N5O5 — CID 4271238
methyl 1-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 4271238) has the molecular formula C24H23N5O5 and a molecular weight of 461.48 g/mol. Its IUPAC name is methyl 1-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 1-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 4271238 |
| Molecular Formula | C24H23N5O5 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | methyl 1-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)C1Cc2c([nH]c3ccccc23)C(c2ccc(OC)c(Cn3cc([N+](=O)[O-])cn3)c2)N1 |
| InChI | InChI=1S/C24H23N5O5/c1-33-21-8-7-14(9-15(21)12-28-13-16(11-25-28)29(31)32)22-23-18(10-20(27-22)24(30)34-2)17-5-3-4-6-19(17)26-23/h3-9,11,13,20,22,26-27H,10,12H2,1-2H3 |
| InChIKey | OAGMADWMPRUXJB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 124.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|