C29H29N3O3 — CID 94063600
(1S,3R)-1-[3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methoxyphenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 94063600) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is (1S,3R)-1-[3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methoxyphenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | (1S,3R)-1-[3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methoxyphenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 94063600 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | (1S,3R)-1-[3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methoxyphenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | COc1ccc([C@@H]2N[C@@H](C(=O)O)Cc3c2[nH]c2ccccc32)cc1CN1CCCc2ccccc21 |
| InChI | InChI=1S/C29H29N3O3/c1-35-26-13-12-19(15-20(26)17-32-14-6-8-18-7-2-5-11-25(18)32)27-28-22(16-24(31-27)29(33)34)21-9-3-4-10-23(21)30-28/h2-5,7,9-13,15,24,27,30-31H,6,8,14,16-17H2,1H3,(H,33,34)/t24-,27+/m1/s1 |
| InChIKey | FEGKPGYYJWVPHL-SQHAQQRYSA-N |
| XLogP | 4.82 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|