C24H21N5O5 — CID 2888463
3-(furan-2-ylmethyl)-2-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-1,2-dihydroquinazolin-4-one (PubChem CID 2888463) has the molecular formula C24H21N5O5 and a molecular weight of 459.46 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-2-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-1,2-dihydroquinazolin-4-one.
| Compound Name | 3-(furan-2-ylmethyl)-2-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 2888463 |
| Molecular Formula | C24H21N5O5 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 3-(furan-2-ylmethyl)-2-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-1,2-dihydroquinazolin-4-one |
| SMILES | COc1ccc(C2Nc3ccccc3C(=O)N2Cc2ccco2)cc1Cn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C24H21N5O5/c1-33-22-9-8-16(11-17(22)13-27-14-18(12-25-27)29(31)32)23-26-21-7-3-2-6-20(21)24(30)28(23)15-19-5-4-10-34-19/h2-12,14,23,26H,13,15H2,1H3 |
| InChIKey | OKWXLWDRYUNJFP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 115.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|