C24H26N2O5 — CID 54777616
2-[4-(2-ethoxyethoxy)-3-methoxyphenyl]-3-(furan-2-ylmethyl)-1,2-dihydroquinazolin-4-one (PubChem CID 54777616) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is 2-[4-(2-ethoxyethoxy)-3-methoxyphenyl]-3-(furan-2-ylmethyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | 2-[4-(2-ethoxyethoxy)-3-methoxyphenyl]-3-(furan-2-ylmethyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 54777616 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 2-[4-(2-ethoxyethoxy)-3-methoxyphenyl]-3-(furan-2-ylmethyl)-1,2-dihydroquinazolin-4-one |
| SMILES | CCOCCOc1ccc(C2Nc3ccccc3C(=O)N2Cc2ccco2)cc1OC |
| InChI | InChI=1S/C24H26N2O5/c1-3-29-13-14-31-21-11-10-17(15-22(21)28-2)23-25-20-9-5-4-8-19(20)24(27)26(23)16-18-7-6-12-30-18/h4-12,15,23,25H,3,13-14,16H2,1-2H3 |
| InChIKey | QWAWISZRTLJZGW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|