C19H19ClN2O6 — CID 169391637
ethyl 4-(4-acetyloxy-3-chloro-5-methoxyphenyl)-6-amino-5-cyano-2-methyl-4H-pyran-3-carboxylate (PubChem CID 169391637) has the molecular formula C19H19ClN2O6 and a molecular weight of 406.82 g/mol. Its IUPAC name is ethyl 4-(4-acetyloxy-3-chloro-5-methoxyphenyl)-6-amino-5-cyano-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 4-(4-acetyloxy-3-chloro-5-methoxyphenyl)-6-amino-5-cyano-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169391637 |
| Molecular Formula | C19H19ClN2O6 |
| Molecular Weight | 406.82 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | ethyl 4-(4-acetyloxy-3-chloro-5-methoxyphenyl)-6-amino-5-cyano-2-methyl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1cc(Cl)c(OC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C19H19ClN2O6/c1-5-26-19(24)15-9(2)27-18(22)12(8-21)16(15)11-6-13(20)17(28-10(3)23)14(7-11)25-4/h6-7,16H,5,22H2,1-4H3 |
| InChIKey | QDABFWWZBFEUGB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 120.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.82 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|