C20H22N4O6 — CID 169391677
ethyl 6-amino-5-cyano-2-methyl-4-(5-morpholin-4-yl-2-nitrophenyl)-4H-pyran-3-carboxylate (PubChem CID 169391677) has the molecular formula C20H22N4O6 and a molecular weight of 414.42 g/mol. Its IUPAC name is ethyl 6-amino-5-cyano-2-methyl-4-(5-morpholin-4-yl-2-nitrophenyl)-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-5-cyano-2-methyl-4-(5-morpholin-4-yl-2-nitrophenyl)-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169391677 |
| Molecular Formula | C20H22N4O6 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | ethyl 6-amino-5-cyano-2-methyl-4-(5-morpholin-4-yl-2-nitrophenyl)-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1cc(N2CCOCC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H22N4O6/c1-3-29-20(25)17-12(2)30-19(22)15(11-21)18(17)14-10-13(4-5-16(14)24(26)27)23-6-8-28-9-7-23/h4-5,10,18H,3,6-9,22H2,1-2H3 |
| InChIKey | ZEEKZJQBVCTPOE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 140.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|