C17H16BrN3O6 — CID 169391114
ethyl 6-amino-4-(3-bromo-2-hydroxy-4-methyl-5-nitrophenyl)-5-cyano-2-methyl-4H-pyran-3-carboxylate (PubChem CID 169391114) has the molecular formula C17H16BrN3O6 and a molecular weight of 438.23 g/mol. Its IUPAC name is ethyl 6-amino-4-(3-bromo-2-hydroxy-4-methyl-5-nitrophenyl)-5-cyano-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-4-(3-bromo-2-hydroxy-4-methyl-5-nitrophenyl)-5-cyano-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169391114 |
| Molecular Formula | C17H16BrN3O6 |
| Molecular Weight | 438.23 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | ethyl 6-amino-4-(3-bromo-2-hydroxy-4-methyl-5-nitrophenyl)-5-cyano-2-methyl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1cc([N+](=O)[O-])c(C)c(Br)c1O |
| InChI | InChI=1S/C17H16BrN3O6/c1-4-26-17(23)12-8(3)27-16(20)10(6-19)13(12)9-5-11(21(24)25)7(2)14(18)15(9)22/h5,13,22H,4,20H2,1-3H3 |
| InChIKey | UDDWAWLNSXPCEN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 148.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|