C17H16BrN3O7 — CID 169391130
ethyl 6-amino-4-(2-bromo-6-hydroxy-5-methoxy-3-nitrophenyl)-5-cyano-2-methyl-4H-pyran-3-carboxylate (PubChem CID 169391130) has the molecular formula C17H16BrN3O7 and a molecular weight of 454.23 g/mol. Its IUPAC name is ethyl 6-amino-4-(2-bromo-6-hydroxy-5-methoxy-3-nitrophenyl)-5-cyano-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-4-(2-bromo-6-hydroxy-5-methoxy-3-nitrophenyl)-5-cyano-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169391130 |
| Molecular Formula | C17H16BrN3O7 |
| Molecular Weight | 454.23 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | ethyl 6-amino-4-(2-bromo-6-hydroxy-5-methoxy-3-nitrophenyl)-5-cyano-2-methyl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1c(O)c(OC)cc([N+](=O)[O-])c1Br |
| InChI | InChI=1S/C17H16BrN3O7/c1-4-27-17(23)11-7(2)28-16(20)8(6-19)12(11)13-14(18)9(21(24)25)5-10(26-3)15(13)22/h5,12,22H,4,20H2,1-3H3 |
| InChIKey | ZGCWKQFXHCAMSB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 157.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|