C17H16ClN3O6 — CID 169390502
ethyl 6-amino-4-[3-(chloromethyl)-2-hydroxy-5-nitrophenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate (PubChem CID 169390502) has the molecular formula C17H16ClN3O6 and a molecular weight of 393.78 g/mol. Its IUPAC name is ethyl 6-amino-4-[3-(chloromethyl)-2-hydroxy-5-nitrophenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-4-[3-(chloromethyl)-2-hydroxy-5-nitrophenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169390502 |
| Molecular Formula | C17H16ClN3O6 |
| Molecular Weight | 393.78 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | ethyl 6-amino-4-[3-(chloromethyl)-2-hydroxy-5-nitrophenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1cc([N+](=O)[O-])cc(CCl)c1O |
| InChI | InChI=1S/C17H16ClN3O6/c1-3-26-17(23)13-8(2)27-16(20)12(7-19)14(13)11-5-10(21(24)25)4-9(6-18)15(11)22/h4-5,14,22H,3,6,20H2,1-2H3 |
| InChIKey | SCWVJFKNULGXHM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 148.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.78 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|