C26H27N3O6 — CID 169391342
ethyl 6-amino-4-[2-(4-tert-butylphenoxy)-5-nitrophenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate (PubChem CID 169391342) has the molecular formula C26H27N3O6 and a molecular weight of 477.52 g/mol. Its IUPAC name is ethyl 6-amino-4-[2-(4-tert-butylphenoxy)-5-nitrophenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-4-[2-(4-tert-butylphenoxy)-5-nitrophenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169391342 |
| Molecular Formula | C26H27N3O6 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | ethyl 6-amino-4-[2-(4-tert-butylphenoxy)-5-nitrophenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1cc([N+](=O)[O-])ccc1Oc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H27N3O6/c1-6-33-25(30)22-15(2)34-24(28)20(14-27)23(22)19-13-17(29(31)32)9-12-21(19)35-18-10-7-16(8-11-18)26(3,4)5/h7-13,23H,6,28H2,1-5H3 |
| InChIKey | BWLLJUNICHLZRJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|