C24H32N4O4 — CID 169391765
ethyl 6-amino-5-cyano-2-methyl-4-[3-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-4H-pyran-3-carboxylate (PubChem CID 169391765) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is ethyl 6-amino-5-cyano-2-methyl-4-[3-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-5-cyano-2-methyl-4-[3-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169391765 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | ethyl 6-amino-5-cyano-2-methyl-4-[3-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1cccc(OCCCN2CCN(C)CC2)c1 |
| InChI | InChI=1S/C24H32N4O4/c1-4-30-24(29)21-17(2)32-23(26)20(16-25)22(21)18-7-5-8-19(15-18)31-14-6-9-28-12-10-27(3)11-13-28/h5,7-8,15,22H,4,6,9-14,26H2,1-3H3 |
| InChIKey | BJADQAKCTWEFQH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|