C18H15FN2O3S — CID 169392487
ethyl 6-amino-5-cyano-4-(5-fluoro-1-benzothiophen-6-yl)-2-methyl-4H-pyran-3-carboxylate (PubChem CID 169392487) has the molecular formula C18H15FN2O3S and a molecular weight of 358.39 g/mol. Its IUPAC name is ethyl 6-amino-5-cyano-4-(5-fluoro-1-benzothiophen-6-yl)-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-5-cyano-4-(5-fluoro-1-benzothiophen-6-yl)-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169392487 |
| Molecular Formula | C18H15FN2O3S |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | ethyl 6-amino-5-cyano-4-(5-fluoro-1-benzothiophen-6-yl)-2-methyl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1cc2sccc2cc1F |
| InChI | InChI=1S/C18H15FN2O3S/c1-3-23-18(22)15-9(2)24-17(21)12(8-20)16(15)11-7-14-10(4-5-25-14)6-13(11)19/h4-7,16H,3,21H2,1-2H3 |
| InChIKey | SZJPODWRKMFOKM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |