C20H11F3N4O2 — CID 169393715
2-amino-6-oxo-4-[2-[(2,3,4-trifluorophenoxy)methyl]phenyl]-1H-pyridine-3,5-dicarbonitrile (PubChem CID 169393715) has the molecular formula C20H11F3N4O2 and a molecular weight of 396.33 g/mol. Its IUPAC name is 2-amino-6-oxo-4-[2-[(2,3,4-trifluorophenoxy)methyl]phenyl]-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-oxo-4-[2-[(2,3,4-trifluorophenoxy)methyl]phenyl]-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169393715 |
| Molecular Formula | C20H11F3N4O2 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2-amino-6-oxo-4-[2-[(2,3,4-trifluorophenoxy)methyl]phenyl]-1H-pyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)[nH]c(=O)c(C#N)c1-c1ccccc1COc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H11F3N4O2/c21-14-5-6-15(18(23)17(14)22)29-9-10-3-1-2-4-11(10)16-12(7-24)19(26)27-20(28)13(16)8-25/h1-6H,9H2,(H3,26,27,28) |
| InChIKey | PRRLDLPGXRSMPI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|