C15H11ClN4OS — CID 169403301
5-[4-(2-chlorophenyl)sulfanylphenyl]-2H-triazole-4-carboxamide (PubChem CID 169403301) has the molecular formula C15H11ClN4OS and a molecular weight of 330.80 g/mol. Its IUPAC name is 5-[4-(2-chlorophenyl)sulfanylphenyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-[4-(2-chlorophenyl)sulfanylphenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169403301 |
| Molecular Formula | C15H11ClN4OS |
| Molecular Weight | 330.80 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 5-[4-(2-chlorophenyl)sulfanylphenyl]-2H-triazole-4-carboxamide |
| SMILES | NC(=O)c1n[nH]nc1-c1ccc(Sc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C15H11ClN4OS/c16-11-3-1-2-4-12(11)22-10-7-5-9(6-8-10)13-14(15(17)21)19-20-18-13/h1-8H,(H2,17,21)(H,18,19,20) |
| InChIKey | LYBGPNQUGAXVIW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.80 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |