C18H17N3O7 — CID 169406948
2-amino-4-[2-(3-cyanopropoxy)-3-methoxyphenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169406948) has the molecular formula C18H17N3O7 and a molecular weight of 387.35 g/mol. Its IUPAC name is 2-amino-4-[2-(3-cyanopropoxy)-3-methoxyphenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-[2-(3-cyanopropoxy)-3-methoxyphenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169406948 |
| Molecular Formula | C18H17N3O7 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 2-amino-4-[2-(3-cyanopropoxy)-3-methoxyphenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | COc1cccc(-c2c(C(=O)O)c(N)[nH]c(=O)c2C(=O)O)c1OCCCC#N |
| InChI | InChI=1S/C18H17N3O7/c1-27-10-6-4-5-9(14(10)28-8-3-2-7-19)11-12(17(23)24)15(20)21-16(22)13(11)18(25)26/h4-6H,2-3,8H2,1H3,(H,23,24)(H,25,26)(H3,20,21,22) |
| InChIKey | SSNWNJYTPZHTOG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 175.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|