C14H15N5O3 — CID 169403937
5-[2-(3-cyanopropoxy)-3-methoxyphenyl]-2H-triazole-4-carboxamide (PubChem CID 169403937) has the molecular formula C14H15N5O3 and a molecular weight of 301.31 g/mol. Its IUPAC name is 5-[2-(3-cyanopropoxy)-3-methoxyphenyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-[2-(3-cyanopropoxy)-3-methoxyphenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169403937 |
| Molecular Formula | C14H15N5O3 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 5-[2-(3-cyanopropoxy)-3-methoxyphenyl]-2H-triazole-4-carboxamide |
| SMILES | COc1cccc(-c2n[nH]nc2C(N)=O)c1OCCCC#N |
| InChI | InChI=1S/C14H15N5O3/c1-21-10-6-4-5-9(13(10)22-8-3-2-7-15)11-12(14(16)20)18-19-17-11/h4-6H,2-3,8H2,1H3,(H2,16,20)(H,17,18,19) |
| InChIKey | YJQJHZZZWFUYAJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 126.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|