About 2-amino-4-[3-(difluoromethoxy)-5-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid
2-amino-4-[3-(difluoromethoxy)-5-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169407409) has the molecular formula C14H9F3N2O6
and a molecular weight of 358.23 g/mol. Its IUPAC name is 2-amino-4-[3-(difluoromethoxy)-5-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
Molecular Properties
| Compound Name | 2-amino-4-[3-(difluoromethoxy)-5-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| PubChem CID | 169407409 |
| Molecular Formula | C14H9F3N2O6 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2-amino-4-[3-(difluoromethoxy)-5-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | Nc1[nH]c(=O)c(C(=O)O)c(-c2cc(F)cc(OC(F)F)c2)c1C(=O)O |
| InChI | InChI=1S/C14H9F3N2O6/c15-5-1-4(2-6(3-5)25-14(16)17)7-8(12(21)22)10(18)19-11(20)9(7)13(23)24/h1-3,14H,(H,21,22)(H,23,24)(H3,18,19,20) |
| InChIKey | MOHTVIYQRYSWLU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 142.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-4-[3-(difluoromethoxy)-5-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-[3-(difluoromethoxy)-5-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
The IUPAC name of 2-amino-4-[3-(difluoromethoxy)-5-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid (CID 169407409) is 2-amino-4-[3-(difluoromethoxy)-5-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
What is the SMILES notation for 2-amino-4-[3-(difluoromethoxy)-5-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
The canonical SMILES for 2-amino-4-[3-(difluoromethoxy)-5-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid is Nc1[nH]c(=O)c(C(=O)O)c(-c2cc(F)cc(OC(F)F)c2)c1C(=O)O.
What is the InChIKey of 2-amino-4-[3-(difluoromethoxy)-5-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
The InChIKey is MOHTVIYQRYSWLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F3N2O6/c15-5-1-4(2-6(3-5)25-14(16)17)7-8(12(21)22)10(18)19-11(20)9(7)13(23)24/h1-3,14H,(H,21,22)(H,23,24)(H3,18,19,20).
What are the key properties of 2-amino-4-[3-(difluoromethoxy)-5-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
2-amino-4-[3-(difluoromethoxy)-5-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid has a molecular weight of 358.23 g/mol, XLogP of 1.76, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-[3-(difluoromethoxy)-5-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid is sourced from PubChem (CID 169407409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).