C14H9Br2FN2O5 — CID 169407846
2-amino-4-[4-bromo-2-(bromomethyl)-3-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169407846) has the molecular formula C14H9Br2FN2O5 and a molecular weight of 464.04 g/mol. Its IUPAC name is 2-amino-4-[4-bromo-2-(bromomethyl)-3-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-[4-bromo-2-(bromomethyl)-3-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169407846 |
| Molecular Formula | C14H9Br2FN2O5 |
| Molecular Weight | 464.04 g/mol |
| Exact Mass | 461.89 |
| IUPAC Name | 2-amino-4-[4-bromo-2-(bromomethyl)-3-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | Nc1[nH]c(=O)c(C(=O)O)c(-c2ccc(Br)c(F)c2CBr)c1C(=O)O |
| InChI | InChI=1S/C14H9Br2FN2O5/c15-3-5-4(1-2-6(16)10(5)17)7-8(13(21)22)11(18)19-12(20)9(7)14(23)24/h1-2H,3H2,(H,21,22)(H,23,24)(H3,18,19,20) |
| InChIKey | MYDFGKMSVPXIAE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 133.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.04 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|