C14H10BrFN2O5 — CID 169407796
2-amino-4-[5-(bromomethyl)-2-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169407796) has the molecular formula C14H10BrFN2O5 and a molecular weight of 385.15 g/mol. Its IUPAC name is 2-amino-4-[5-(bromomethyl)-2-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-[5-(bromomethyl)-2-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169407796 |
| Molecular Formula | C14H10BrFN2O5 |
| Molecular Weight | 385.15 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | 2-amino-4-[5-(bromomethyl)-2-fluorophenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | Nc1[nH]c(=O)c(C(=O)O)c(-c2cc(CBr)ccc2F)c1C(=O)O |
| InChI | InChI=1S/C14H10BrFN2O5/c15-4-5-1-2-7(16)6(3-5)8-9(13(20)21)11(17)18-12(19)10(8)14(22)23/h1-3H,4H2,(H,20,21)(H,22,23)(H3,17,18,19) |
| InChIKey | DXHKTVYIILDARW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 133.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.15 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|