C18H11F2N3O5 — CID 169407912
2-amino-4-[2-fluoro-5-(6-fluoro-3-pyridinyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169407912) has the molecular formula C18H11F2N3O5 and a molecular weight of 387.30 g/mol. Its IUPAC name is 2-amino-4-[2-fluoro-5-(6-fluoro-3-pyridinyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-[2-fluoro-5-(6-fluoro-3-pyridinyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169407912 |
| Molecular Formula | C18H11F2N3O5 |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 2-amino-4-[2-fluoro-5-(6-fluoro-3-pyridinyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | Nc1[nH]c(=O)c(C(=O)O)c(-c2cc(-c3ccc(F)nc3)ccc2F)c1C(=O)O |
| InChI | InChI=1S/C18H11F2N3O5/c19-10-3-1-7(8-2-4-11(20)22-6-8)5-9(10)12-13(17(25)26)15(21)23-16(24)14(12)18(27)28/h1-6H,(H,25,26)(H,27,28)(H3,21,23,24) |
| InChIKey | DAJPHMQYQHOBDJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 146.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|